C23H21ClN2O2 — CID 43060389
[2-(4-chlorophenyl)pyrrolidin-1-yl]-[4-(pyridin-3-ylmethoxy)phenyl]methanone (PubChem CID 43060389) has the molecular formula C23H21ClN2O2 and a molecular weight of 392.89 g/mol. Its IUPAC name is [2-(4-chlorophenyl)pyrrolidin-1-yl]-[4-(pyridin-3-ylmethoxy)phenyl]methanone.
| Compound Name | [2-(4-chlorophenyl)pyrrolidin-1-yl]-[4-(pyridin-3-ylmethoxy)phenyl]methanone |
|---|---|
| PubChem CID | 43060389 |
| Molecular Formula | C23H21ClN2O2 |
| Molecular Weight | 392.89 g/mol |
| Exact Mass | 392.13 |
| IUPAC Name | [2-(4-chlorophenyl)pyrrolidin-1-yl]-[4-(pyridin-3-ylmethoxy)phenyl]methanone |
| SMILES | O=C(c1ccc(OCc2cccnc2)cc1)N1CCCC1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C23H21ClN2O2/c24-20-9-5-18(6-10-20)22-4-2-14-26(22)23(27)19-7-11-21(12-8-19)28-16-17-3-1-13-25-15-17/h1,3,5-13,15,22H,2,4,14,16H2 |
| InChIKey | OFUAYMWPPSMEGB-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.89 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |