C21H24N4O4 — CID 86274684
[4-[4-(2-methoxypyrimidin-5-yl)benzoyl]piperazin-1-yl]-[(2S)-oxolan-2-yl]methanone (PubChem CID 86274684) has the molecular formula C21H24N4O4 and a molecular weight of 396.45 g/mol. Its IUPAC name is [4-[4-(2-methoxypyrimidin-5-yl)benzoyl]piperazin-1-yl]-[(2S)-oxolan-2-yl]methanone.
| Compound Name | [4-[4-(2-methoxypyrimidin-5-yl)benzoyl]piperazin-1-yl]-[(2S)-oxolan-2-yl]methanone |
|---|---|
| PubChem CID | 86274684 |
| Molecular Formula | C21H24N4O4 |
| Molecular Weight | 396.45 g/mol |
| Exact Mass | 396.18 |
| IUPAC Name | [4-[4-(2-methoxypyrimidin-5-yl)benzoyl]piperazin-1-yl]-[(2S)-oxolan-2-yl]methanone |
| SMILES | COc1ncc(-c2ccc(C(=O)N3CCN(C(=O)[C@@H]4CCCO4)CC3)cc2)cn1 |
| InChI | InChI=1S/C21H24N4O4/c1-28-21-22-13-17(14-23-21)15-4-6-16(7-5-15)19(26)24-8-10-25(11-9-24)20(27)18-3-2-12-29-18/h4-7,13-14,18H,2-3,8-12H2,1H3/t18-/m0/s1 |
| InChIKey | MFDNSVFCFOHMRH-SFHVURJKSA-N |
| XLogP | 1.62 |
| TPSA | 84.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.45 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |