C22H27N3O3 — CID 4878720
[4-[4-(2,5-dimethylpyrrol-1-yl)benzoyl]piperazin-1-yl]-(oxolan-2-yl)methanone (PubChem CID 4878720) has the molecular formula C22H27N3O3 and a molecular weight of 381.48 g/mol. Its IUPAC name is [4-[4-(2,5-dimethylpyrrol-1-yl)benzoyl]piperazin-1-yl]-(oxolan-2-yl)methanone.
| Compound Name | [4-[4-(2,5-dimethylpyrrol-1-yl)benzoyl]piperazin-1-yl]-(oxolan-2-yl)methanone |
|---|---|
| PubChem CID | 4878720 |
| Molecular Formula | C22H27N3O3 |
| Molecular Weight | 381.48 g/mol |
| Exact Mass | 381.21 |
| IUPAC Name | [4-[4-(2,5-dimethylpyrrol-1-yl)benzoyl]piperazin-1-yl]-(oxolan-2-yl)methanone |
| SMILES | Cc1ccc(C)n1-c1ccc(C(=O)N2CCN(C(=O)C3CCCO3)CC2)cc1 |
| InChI | InChI=1S/C22H27N3O3/c1-16-5-6-17(2)25(16)19-9-7-18(8-10-19)21(26)23-11-13-24(14-12-23)22(27)20-4-3-15-28-20/h5-10,20H,3-4,11-15H2,1-2H3 |
| InChIKey | IVOPSAVQXUMXOP-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 54.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.48 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|