C23H33N3O5S — CID 55406002
N-cyclohexyl-N-methyl-4-[4-(oxolane-2-carbonyl)piperazine-1-carbonyl]benzenesulfonamide (PubChem CID 55406002) has the molecular formula C23H33N3O5S and a molecular weight of 463.60 g/mol. Its IUPAC name is N-cyclohexyl-N-methyl-4-[4-(oxolane-2-carbonyl)piperazine-1-carbonyl]benzenesulfonamide.
| Compound Name | N-cyclohexyl-N-methyl-4-[4-(oxolane-2-carbonyl)piperazine-1-carbonyl]benzenesulfonamide |
|---|---|
| PubChem CID | 55406002 |
| Molecular Formula | C23H33N3O5S |
| Molecular Weight | 463.60 g/mol |
| Exact Mass | 463.21 |
| IUPAC Name | N-cyclohexyl-N-methyl-4-[4-(oxolane-2-carbonyl)piperazine-1-carbonyl]benzenesulfonamide |
| SMILES | CN(C1CCCCC1)S(=O)(=O)c1ccc(C(=O)N2CCN(C(=O)C3CCCO3)CC2)cc1 |
| InChI | InChI=1S/C23H33N3O5S/c1-24(19-6-3-2-4-7-19)32(29,30)20-11-9-18(10-12-20)22(27)25-13-15-26(16-14-25)23(28)21-8-5-17-31-21/h9-12,19,21H,2-8,13-17H2,1H3 |
| InChIKey | SWMITJVNVKAQDA-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 87.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.60 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |