C21H22ClN3O3 — CID 86274440
[4-[4-(5-chloro-3-pyridinyl)benzoyl]piperazin-1-yl]-[(2S)-oxolan-2-yl]methanone (PubChem CID 86274440) has the molecular formula C21H22ClN3O3 and a molecular weight of 399.88 g/mol. Its IUPAC name is [4-[4-(5-chloro-3-pyridinyl)benzoyl]piperazin-1-yl]-[(2S)-oxolan-2-yl]methanone.
| Compound Name | [4-[4-(5-chloro-3-pyridinyl)benzoyl]piperazin-1-yl]-[(2S)-oxolan-2-yl]methanone |
|---|---|
| PubChem CID | 86274440 |
| Molecular Formula | C21H22ClN3O3 |
| Molecular Weight | 399.88 g/mol |
| Exact Mass | 399.13 |
| IUPAC Name | [4-[4-(5-chloro-3-pyridinyl)benzoyl]piperazin-1-yl]-[(2S)-oxolan-2-yl]methanone |
| SMILES | O=C(c1ccc(-c2cncc(Cl)c2)cc1)N1CCN(C(=O)[C@@H]2CCCO2)CC1 |
| InChI | InChI=1S/C21H22ClN3O3/c22-18-12-17(13-23-14-18)15-3-5-16(6-4-15)20(26)24-7-9-25(10-8-24)21(27)19-2-1-11-28-19/h3-6,12-14,19H,1-2,7-11H2/t19-/m0/s1 |
| InChIKey | OQLSIYPAYMSSLP-IBGZPJMESA-N |
| XLogP | 2.87 |
| TPSA | 62.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.88 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |