C16H17FN6O2 — CID 133185705
4-(4-fluorophenyl)-N'-(3-nitro-2-pyridinyl)piperazine-1-carboximidamide (PubChem CID 133185705) has the molecular formula C16H17FN6O2 and a molecular weight of 344.35 g/mol. Its IUPAC name is 4-(4-fluorophenyl)-N'-(3-nitro-2-pyridinyl)piperazine-1-carboximidamide.
| Compound Name | 4-(4-fluorophenyl)-N'-(3-nitro-2-pyridinyl)piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 133185705 |
| Molecular Formula | C16H17FN6O2 |
| Molecular Weight | 344.35 g/mol |
| Exact Mass | 344.14 |
| IUPAC Name | 4-(4-fluorophenyl)-N'-(3-nitro-2-pyridinyl)piperazine-1-carboximidamide |
| SMILES | N/C(=N\c1ncccc1[N+](=O)[O-])N1CCN(c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C16H17FN6O2/c17-12-3-5-13(6-4-12)21-8-10-22(11-9-21)16(18)20-15-14(23(24)25)2-1-7-19-15/h1-7H,8-11H2,(H2,18,19,20) |
| InChIKey | RTXVLYSOXINEJF-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 100.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.35 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|