C19H23FIN5O3 — CID 119120062
4-(4-fluorophenyl)-N'-[(4-methoxy-3-nitrophenyl)methyl]piperazine-1-carboximidamide;hydroiodide (PubChem CID 119120062) has the molecular formula C19H23FIN5O3 and a molecular weight of 515.33 g/mol. Its IUPAC name is 4-(4-fluorophenyl)-N'-[(4-methoxy-3-nitrophenyl)methyl]piperazine-1-carboximidamide;hydroiodide.
| Compound Name | 4-(4-fluorophenyl)-N'-[(4-methoxy-3-nitrophenyl)methyl]piperazine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 119120062 |
| Molecular Formula | C19H23FIN5O3 |
| Molecular Weight | 515.33 g/mol |
| Exact Mass | 515.08 |
| IUPAC Name | 4-(4-fluorophenyl)-N'-[(4-methoxy-3-nitrophenyl)methyl]piperazine-1-carboximidamide;hydroiodide |
| SMILES | COc1ccc(C/N=C(\N)N2CCN(c3ccc(F)cc3)CC2)cc1[N+](=O)[O-].I |
| InChI | InChI=1S/C19H22FN5O3.HI/c1-28-18-7-2-14(12-17(18)25(26)27)13-22-19(21)24-10-8-23(9-11-24)16-5-3-15(20)4-6-16;/h2-7,12H,8-11,13H2,1H3,(H2,21,22);1H |
| InChIKey | ARSGWIXDKWCGHN-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 97.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.33 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|