C17H22IN7O3 — CID 119120064
N'-[(4-methoxy-3-nitrophenyl)methyl]-4-pyrimidin-2-ylpiperazine-1-carboximidamide;hydroiodide (PubChem CID 119120064) has the molecular formula C17H22IN7O3 and a molecular weight of 499.31 g/mol. Its IUPAC name is N'-[(4-methoxy-3-nitrophenyl)methyl]-4-pyrimidin-2-ylpiperazine-1-carboximidamide;hydroiodide.
| Compound Name | N'-[(4-methoxy-3-nitrophenyl)methyl]-4-pyrimidin-2-ylpiperazine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 119120064 |
| Molecular Formula | C17H22IN7O3 |
| Molecular Weight | 499.31 g/mol |
| Exact Mass | 499.08 |
| IUPAC Name | N'-[(4-methoxy-3-nitrophenyl)methyl]-4-pyrimidin-2-ylpiperazine-1-carboximidamide;hydroiodide |
| SMILES | COc1ccc(C/N=C(\N)N2CCN(c3ncccn3)CC2)cc1[N+](=O)[O-].I |
| InChI | InChI=1S/C17H21N7O3.HI/c1-27-15-4-3-13(11-14(15)24(25)26)12-21-16(18)22-7-9-23(10-8-22)17-19-5-2-6-20-17;/h2-6,11H,7-10,12H2,1H3,(H2,18,21);1H |
| InChIKey | BSWAZZPCGFUSOL-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 123.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.31 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|