C22H25FN4O2 — CID 111096763
4-(4-fluorophenyl)-N'-[(4-methoxy-3-prop-2-ynoxyphenyl)methyl]piperazine-1-carboximidamide (PubChem CID 111096763) has the molecular formula C22H25FN4O2 and a molecular weight of 396.47 g/mol. Its IUPAC name is 4-(4-fluorophenyl)-N'-[(4-methoxy-3-prop-2-ynoxyphenyl)methyl]piperazine-1-carboximidamide.
| Compound Name | 4-(4-fluorophenyl)-N'-[(4-methoxy-3-prop-2-ynoxyphenyl)methyl]piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 111096763 |
| Molecular Formula | C22H25FN4O2 |
| Molecular Weight | 396.47 g/mol |
| Exact Mass | 396.20 |
| IUPAC Name | 4-(4-fluorophenyl)-N'-[(4-methoxy-3-prop-2-ynoxyphenyl)methyl]piperazine-1-carboximidamide |
| SMILES | C#CCOc1cc(C/N=C(\N)N2CCN(c3ccc(F)cc3)CC2)ccc1OC |
| InChI | InChI=1S/C22H25FN4O2/c1-3-14-29-21-15-17(4-9-20(21)28-2)16-25-22(24)27-12-10-26(11-13-27)19-7-5-18(23)6-8-19/h1,4-9,15H,10-14,16H2,2H3,(H2,24,25) |
| InChIKey | AYGNGNBNMRGTIB-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.47 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|