C18H21ClFN5O — CID 122097417
N'-[(5-chloro-6-methoxy-3-pyridinyl)methyl]-4-(4-fluorophenyl)piperazine-1-carboximidamide (PubChem CID 122097417) has the molecular formula C18H21ClFN5O and a molecular weight of 377.85 g/mol. Its IUPAC name is N'-[(5-chloro-6-methoxy-3-pyridinyl)methyl]-4-(4-fluorophenyl)piperazine-1-carboximidamide.
| Compound Name | N'-[(5-chloro-6-methoxy-3-pyridinyl)methyl]-4-(4-fluorophenyl)piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 122097417 |
| Molecular Formula | C18H21ClFN5O |
| Molecular Weight | 377.85 g/mol |
| Exact Mass | 377.14 |
| IUPAC Name | N'-[(5-chloro-6-methoxy-3-pyridinyl)methyl]-4-(4-fluorophenyl)piperazine-1-carboximidamide |
| SMILES | COc1ncc(C/N=C(\N)N2CCN(c3ccc(F)cc3)CC2)cc1Cl |
| InChI | InChI=1S/C18H21ClFN5O/c1-26-17-16(19)10-13(11-22-17)12-23-18(21)25-8-6-24(7-9-25)15-4-2-14(20)3-5-15/h2-5,10-11H,6-9,12H2,1H3,(H2,21,23) |
| InChIKey | MJGVTRSYSXVLOM-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 66.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.85 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|