C18H22FN5 — CID 122096482
4-(4-fluorophenyl)-N'-[(4-methyl-2-pyridinyl)methyl]piperazine-1-carboximidamide (PubChem CID 122096482) has the molecular formula C18H22FN5 and a molecular weight of 327.41 g/mol. Its IUPAC name is 4-(4-fluorophenyl)-N'-[(4-methyl-2-pyridinyl)methyl]piperazine-1-carboximidamide.
| Compound Name | 4-(4-fluorophenyl)-N'-[(4-methyl-2-pyridinyl)methyl]piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 122096482 |
| Molecular Formula | C18H22FN5 |
| Molecular Weight | 327.41 g/mol |
| Exact Mass | 327.19 |
| IUPAC Name | 4-(4-fluorophenyl)-N'-[(4-methyl-2-pyridinyl)methyl]piperazine-1-carboximidamide |
| SMILES | Cc1ccnc(C/N=C(\N)N2CCN(c3ccc(F)cc3)CC2)c1 |
| InChI | InChI=1S/C18H22FN5/c1-14-6-7-21-16(12-14)13-22-18(20)24-10-8-23(9-11-24)17-4-2-15(19)3-5-17/h2-7,12H,8-11,13H2,1H3,(H2,20,22) |
| InChIKey | NUAMPJKBPJGZSL-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 57.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.41 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|