C23H30FN7O — CID 111092220
4-(4-fluorophenyl)-N'-[3-oxo-3-(4-pyridin-2-ylpiperazin-1-yl)propyl]piperazine-1-carboximidamide (PubChem CID 111092220) has the molecular formula C23H30FN7O and a molecular weight of 439.54 g/mol. Its IUPAC name is 4-(4-fluorophenyl)-N'-[3-oxo-3-(4-pyridin-2-ylpiperazin-1-yl)propyl]piperazine-1-carboximidamide.
| Compound Name | 4-(4-fluorophenyl)-N'-[3-oxo-3-(4-pyridin-2-ylpiperazin-1-yl)propyl]piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 111092220 |
| Molecular Formula | C23H30FN7O |
| Molecular Weight | 439.54 g/mol |
| Exact Mass | 439.25 |
| IUPAC Name | 4-(4-fluorophenyl)-N'-[3-oxo-3-(4-pyridin-2-ylpiperazin-1-yl)propyl]piperazine-1-carboximidamide |
| SMILES | N/C(=N\CCC(=O)N1CCN(c2ccccn2)CC1)N1CCN(c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C23H30FN7O/c24-19-4-6-20(7-5-19)28-11-17-31(18-12-28)23(25)27-10-8-22(32)30-15-13-29(14-16-30)21-3-1-2-9-26-21/h1-7,9H,8,10-18H2,(H2,25,27) |
| InChIKey | ZTFWQNBVUFVFNR-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 81.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.54 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|