C20H30FN5O — CID 111075503
3-[[amino-[4-(4-fluorophenyl)piperazin-1-yl]methylidene]amino]-N-cyclohexylpropanamide (PubChem CID 111075503) has the molecular formula C20H30FN5O and a molecular weight of 375.49 g/mol. Its IUPAC name is 3-[[amino-[4-(4-fluorophenyl)piperazin-1-yl]methylidene]amino]-N-cyclohexylpropanamide.
| Compound Name | 3-[[amino-[4-(4-fluorophenyl)piperazin-1-yl]methylidene]amino]-N-cyclohexylpropanamide |
|---|---|
| PubChem CID | 111075503 |
| Molecular Formula | C20H30FN5O |
| Molecular Weight | 375.49 g/mol |
| Exact Mass | 375.24 |
| IUPAC Name | 3-[[amino-[4-(4-fluorophenyl)piperazin-1-yl]methylidene]amino]-N-cyclohexylpropanamide |
| SMILES | N/C(=N\CCC(=O)NC1CCCCC1)N1CCN(c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C20H30FN5O/c21-16-6-8-18(9-7-16)25-12-14-26(15-13-25)20(22)23-11-10-19(27)24-17-4-2-1-3-5-17/h6-9,17H,1-5,10-15H2,(H2,22,23)(H,24,27) |
| InChIKey | JGJBPZQIHNURAZ-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 73.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.49 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|