C19H29ClIN5O — CID 111090882
2-[[amino-[4-(4-chlorophenyl)piperazin-1-yl]methylidene]amino]-N-cyclohexylacetamide;hydroiodide (PubChem CID 111090882) has the molecular formula C19H29ClIN5O and a molecular weight of 505.83 g/mol. Its IUPAC name is 2-[[amino-[4-(4-chlorophenyl)piperazin-1-yl]methylidene]amino]-N-cyclohexylacetamide;hydroiodide.
| Compound Name | 2-[[amino-[4-(4-chlorophenyl)piperazin-1-yl]methylidene]amino]-N-cyclohexylacetamide;hydroiodide |
|---|---|
| PubChem CID | 111090882 |
| Molecular Formula | C19H29ClIN5O |
| Molecular Weight | 505.83 g/mol |
| Exact Mass | 505.11 |
| IUPAC Name | 2-[[amino-[4-(4-chlorophenyl)piperazin-1-yl]methylidene]amino]-N-cyclohexylacetamide;hydroiodide |
| SMILES | I.N/C(=N\CC(=O)NC1CCCCC1)N1CCN(c2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C19H28ClN5O.HI/c20-15-6-8-17(9-7-15)24-10-12-25(13-11-24)19(21)22-14-18(26)23-16-4-2-1-3-5-16;/h6-9,16H,1-5,10-14H2,(H2,21,22)(H,23,26);1H |
| InChIKey | ZUFWCPGWIJSUFC-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 73.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.83 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|