C18H28ClIN4O — CID 110018760
4-(4-chlorophenyl)-N'-[2-(oxan-2-yl)ethyl]piperazine-1-carboximidamide;hydroiodide (PubChem CID 110018760) has the molecular formula C18H28ClIN4O and a molecular weight of 478.81 g/mol. Its IUPAC name is 4-(4-chlorophenyl)-N'-[2-(oxan-2-yl)ethyl]piperazine-1-carboximidamide;hydroiodide.
| Compound Name | 4-(4-chlorophenyl)-N'-[2-(oxan-2-yl)ethyl]piperazine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 110018760 |
| Molecular Formula | C18H28ClIN4O |
| Molecular Weight | 478.81 g/mol |
| Exact Mass | 478.10 |
| IUPAC Name | 4-(4-chlorophenyl)-N'-[2-(oxan-2-yl)ethyl]piperazine-1-carboximidamide;hydroiodide |
| SMILES | I.N/C(=N\CCC1CCCCO1)N1CCN(c2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C18H27ClN4O.HI/c19-15-4-6-16(7-5-15)22-10-12-23(13-11-22)18(20)21-9-8-17-3-1-2-14-24-17;/h4-7,17H,1-3,8-14H2,(H2,20,21);1H |
| InChIKey | RSQBSQYECOERRS-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 54.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.81 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|