C19H30ClIN4O — CID 110033350
4-(4-chlorophenyl)-N'-[3-(oxan-2-yl)propyl]piperazine-1-carboximidamide;hydroiodide (PubChem CID 110033350) has the molecular formula C19H30ClIN4O and a molecular weight of 492.83 g/mol. Its IUPAC name is 4-(4-chlorophenyl)-N'-[3-(oxan-2-yl)propyl]piperazine-1-carboximidamide;hydroiodide.
| Compound Name | 4-(4-chlorophenyl)-N'-[3-(oxan-2-yl)propyl]piperazine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 110033350 |
| Molecular Formula | C19H30ClIN4O |
| Molecular Weight | 492.83 g/mol |
| Exact Mass | 492.12 |
| IUPAC Name | 4-(4-chlorophenyl)-N'-[3-(oxan-2-yl)propyl]piperazine-1-carboximidamide;hydroiodide |
| SMILES | I.N/C(=N\CCCC1CCCCO1)N1CCN(c2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C19H29ClN4O.HI/c20-16-6-8-17(9-7-16)23-11-13-24(14-12-23)19(21)22-10-3-5-18-4-1-2-15-25-18;/h6-9,18H,1-5,10-15H2,(H2,21,22);1H |
| InChIKey | DPQIBHBFBYXQTD-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 54.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.83 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|