About 4-(4-chlorophenyl)-N'-[3-(oxan-2-yl)propyl]piperazine-1-carboximidamide;hydroiodide
4-(4-chlorophenyl)-N'-[3-(oxan-2-yl)propyl]piperazine-1-carboximidamide;hydroiodide (PubChem CID 110033350) has the molecular formula C19H30ClIN4O
and a molecular weight of 492.83 g/mol. Its IUPAC name is 4-(4-chlorophenyl)-N'-[3-(oxan-2-yl)propyl]piperazine-1-carboximidamide;hydroiodide.
Molecular Properties
| Compound Name | 4-(4-chlorophenyl)-N'-[3-(oxan-2-yl)propyl]piperazine-1-carboximidamide;hydroiodide |
| PubChem CID | 110033350 |
| Molecular Formula | C19H30ClIN4O |
| Molecular Weight | 492.83 g/mol |
| Exact Mass | 492.12 |
| IUPAC Name | 4-(4-chlorophenyl)-N'-[3-(oxan-2-yl)propyl]piperazine-1-carboximidamide;hydroiodide |
| SMILES | I.N/C(=N\CCCC1CCCCO1)N1CCN(c2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C19H29ClN4O.HI/c20-16-6-8-17(9-7-16)23-11-13-24(14-12-23)19(21)22-10-3-5-18-4-1-2-15-25-18;/h6-9,18H,1-5,10-15H2,(H2,21,22);1H |
| InChIKey | DPQIBHBFBYXQTD-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 54.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 492.83 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 4-(4-chlorophenyl)-N'-[3-(oxan-2-yl)propyl]piperazine-1-carboximidamide;hydroiodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4-chlorophenyl)-N'-[3-(oxan-2-yl)propyl]piperazine-1-carboximidamide;hydroiodide?
The IUPAC name of 4-(4-chlorophenyl)-N'-[3-(oxan-2-yl)propyl]piperazine-1-carboximidamide;hydroiodide (CID 110033350) is 4-(4-chlorophenyl)-N'-[3-(oxan-2-yl)propyl]piperazine-1-carboximidamide;hydroiodide.
What is the SMILES notation for 4-(4-chlorophenyl)-N'-[3-(oxan-2-yl)propyl]piperazine-1-carboximidamide;hydroiodide?
The canonical SMILES for 4-(4-chlorophenyl)-N'-[3-(oxan-2-yl)propyl]piperazine-1-carboximidamide;hydroiodide is I.N/C(=N\CCCC1CCCCO1)N1CCN(c2ccc(Cl)cc2)CC1.
What is the InChIKey of 4-(4-chlorophenyl)-N'-[3-(oxan-2-yl)propyl]piperazine-1-carboximidamide;hydroiodide?
The InChIKey is DPQIBHBFBYXQTD-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H29ClN4O.HI/c20-16-6-8-17(9-7-16)23-11-13-24(14-12-23)19(21)22-10-3-5-18-4-1-2-15-25-18;/h6-9,18H,1-5,10-15H2,(H2,21,22);1H.
What are the key properties of 4-(4-chlorophenyl)-N'-[3-(oxan-2-yl)propyl]piperazine-1-carboximidamide;hydroiodide?
4-(4-chlorophenyl)-N'-[3-(oxan-2-yl)propyl]piperazine-1-carboximidamide;hydroiodide has a molecular weight of 492.83 g/mol, XLogP of 3.74, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-chlorophenyl)-N'-[3-(oxan-2-yl)propyl]piperazine-1-carboximidamide;hydroiodide is sourced from PubChem (CID 110033350), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).