C23H29ClN4O — CID 111075115
4-(4-chlorophenyl)-N'-[(2-phenyloxan-3-yl)methyl]piperazine-1-carboximidamide (PubChem CID 111075115) has the molecular formula C23H29ClN4O and a molecular weight of 412.97 g/mol. Its IUPAC name is 4-(4-chlorophenyl)-N'-[(2-phenyloxan-3-yl)methyl]piperazine-1-carboximidamide.
| Compound Name | 4-(4-chlorophenyl)-N'-[(2-phenyloxan-3-yl)methyl]piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 111075115 |
| Molecular Formula | C23H29ClN4O |
| Molecular Weight | 412.97 g/mol |
| Exact Mass | 412.20 |
| IUPAC Name | 4-(4-chlorophenyl)-N'-[(2-phenyloxan-3-yl)methyl]piperazine-1-carboximidamide |
| SMILES | N/C(=N\CC1CCCOC1c1ccccc1)N1CCN(c2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C23H29ClN4O/c24-20-8-10-21(11-9-20)27-12-14-28(15-13-27)23(25)26-17-19-7-4-16-29-22(19)18-5-2-1-3-6-18/h1-3,5-6,8-11,19,22H,4,7,12-17H2,(H2,25,26) |
| InChIKey | ARXZGNNOPDDNJP-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 54.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.97 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|