C23H30ClIN4O — CID 111068031
4-(4-chlorophenyl)-N'-[(4-phenyloxan-4-yl)methyl]piperazine-1-carboximidamide;hydroiodide (PubChem CID 111068031) has the molecular formula C23H30ClIN4O and a molecular weight of 540.88 g/mol. Its IUPAC name is 4-(4-chlorophenyl)-N'-[(4-phenyloxan-4-yl)methyl]piperazine-1-carboximidamide;hydroiodide.
| Compound Name | 4-(4-chlorophenyl)-N'-[(4-phenyloxan-4-yl)methyl]piperazine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111068031 |
| Molecular Formula | C23H30ClIN4O |
| Molecular Weight | 540.88 g/mol |
| Exact Mass | 540.12 |
| IUPAC Name | 4-(4-chlorophenyl)-N'-[(4-phenyloxan-4-yl)methyl]piperazine-1-carboximidamide;hydroiodide |
| SMILES | I.N/C(=N\CC1(c2ccccc2)CCOCC1)N1CCN(c2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C23H29ClN4O.HI/c24-20-6-8-21(9-7-20)27-12-14-28(15-13-27)22(25)26-18-23(10-16-29-17-11-23)19-4-2-1-3-5-19;/h1-9H,10-18H2,(H2,25,26);1H |
| InChIKey | UTJANCPZBJEXSL-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 54.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.88 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|