C18H26ClN5O2 — CID 111069176
4-[[[amino-[4-(4-chlorophenyl)piperazin-1-yl]methylidene]amino]methyl]oxane-4-carboxamide (PubChem CID 111069176) has the molecular formula C18H26ClN5O2 and a molecular weight of 379.89 g/mol. Its IUPAC name is 4-[[[amino-[4-(4-chlorophenyl)piperazin-1-yl]methylidene]amino]methyl]oxane-4-carboxamide.
| Compound Name | 4-[[[amino-[4-(4-chlorophenyl)piperazin-1-yl]methylidene]amino]methyl]oxane-4-carboxamide |
|---|---|
| PubChem CID | 111069176 |
| Molecular Formula | C18H26ClN5O2 |
| Molecular Weight | 379.89 g/mol |
| Exact Mass | 379.18 |
| IUPAC Name | 4-[[[amino-[4-(4-chlorophenyl)piperazin-1-yl]methylidene]amino]methyl]oxane-4-carboxamide |
| SMILES | NC(=O)C1(C/N=C(\N)N2CCN(c3ccc(Cl)cc3)CC2)CCOCC1 |
| InChI | InChI=1S/C18H26ClN5O2/c19-14-1-3-15(4-2-14)23-7-9-24(10-8-23)17(21)22-13-18(16(20)25)5-11-26-12-6-18/h1-4H,5-13H2,(H2,20,25)(H2,21,22) |
| InChIKey | ZXNMZGOXZQIUMU-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 97.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.89 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|