C15H24N6O2S — CID 111069180
4-[[[amino-[4-(1,3-thiazol-2-yl)piperazin-1-yl]methylidene]amino]methyl]oxane-4-carboxamide (PubChem CID 111069180) has the molecular formula C15H24N6O2S and a molecular weight of 352.46 g/mol. Its IUPAC name is 4-[[[amino-[4-(1,3-thiazol-2-yl)piperazin-1-yl]methylidene]amino]methyl]oxane-4-carboxamide.
| Compound Name | 4-[[[amino-[4-(1,3-thiazol-2-yl)piperazin-1-yl]methylidene]amino]methyl]oxane-4-carboxamide |
|---|---|
| PubChem CID | 111069180 |
| Molecular Formula | C15H24N6O2S |
| Molecular Weight | 352.46 g/mol |
| Exact Mass | 352.17 |
| IUPAC Name | 4-[[[amino-[4-(1,3-thiazol-2-yl)piperazin-1-yl]methylidene]amino]methyl]oxane-4-carboxamide |
| SMILES | NC(=O)C1(C/N=C(\N)N2CCN(c3nccs3)CC2)CCOCC1 |
| InChI | InChI=1S/C15H24N6O2S/c16-12(22)15(1-8-23-9-2-15)11-19-13(17)20-4-6-21(7-5-20)14-18-3-10-24-14/h3,10H,1-2,4-9,11H2,(H2,16,22)(H2,17,19) |
| InChIKey | XNKSZVZQIQFTQO-UHFFFAOYSA-N |
| XLogP | -0.14 |
| TPSA | 110.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.46 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|