C18H26N6OS2 — CID 111027061
N'-(2-morpholin-4-yl-2-thiophen-2-ylethyl)-4-(1,3-thiazol-2-yl)piperazine-1-carboximidamide (PubChem CID 111027061) has the molecular formula C18H26N6OS2 and a molecular weight of 406.58 g/mol. Its IUPAC name is N'-(2-morpholin-4-yl-2-thiophen-2-ylethyl)-4-(1,3-thiazol-2-yl)piperazine-1-carboximidamide.
| Compound Name | N'-(2-morpholin-4-yl-2-thiophen-2-ylethyl)-4-(1,3-thiazol-2-yl)piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 111027061 |
| Molecular Formula | C18H26N6OS2 |
| Molecular Weight | 406.58 g/mol |
| Exact Mass | 406.16 |
| IUPAC Name | N'-(2-morpholin-4-yl-2-thiophen-2-ylethyl)-4-(1,3-thiazol-2-yl)piperazine-1-carboximidamide |
| SMILES | N/C(=N\CC(c1cccs1)N1CCOCC1)N1CCN(c2nccs2)CC1 |
| InChI | InChI=1S/C18H26N6OS2/c19-17(23-4-6-24(7-5-23)18-20-3-13-27-18)21-14-15(16-2-1-12-26-16)22-8-10-25-11-9-22/h1-3,12-13,15H,4-11,14H2,(H2,19,21) |
| InChIKey | SHTBBYDPBJOIAS-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 70.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.58 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|