C18H32IN5OS — CID 111823278
N'-[(1-propoxycyclohexyl)methyl]-4-(1,3-thiazol-2-yl)piperazine-1-carboximidamide;hydroiodide (PubChem CID 111823278) has the molecular formula C18H32IN5OS and a molecular weight of 493.46 g/mol. Its IUPAC name is N'-[(1-propoxycyclohexyl)methyl]-4-(1,3-thiazol-2-yl)piperazine-1-carboximidamide;hydroiodide.
| Compound Name | N'-[(1-propoxycyclohexyl)methyl]-4-(1,3-thiazol-2-yl)piperazine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111823278 |
| Molecular Formula | C18H32IN5OS |
| Molecular Weight | 493.46 g/mol |
| Exact Mass | 493.14 |
| IUPAC Name | N'-[(1-propoxycyclohexyl)methyl]-4-(1,3-thiazol-2-yl)piperazine-1-carboximidamide;hydroiodide |
| SMILES | CCCOC1(C/N=C(\N)N2CCN(c3nccs3)CC2)CCCCC1.I |
| InChI | InChI=1S/C18H31N5OS.HI/c1-2-13-24-18(6-4-3-5-7-18)15-21-16(19)22-9-11-23(12-10-22)17-20-8-14-25-17;/h8,14H,2-7,9-13,15H2,1H3,(H2,19,21);1H |
| InChIKey | TYFWUDPMAQVVKO-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 66.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.46 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|