C21H29N5OS — CID 111079001
N'-[[1-(2-methoxyphenyl)cyclopentyl]methyl]-4-(1,3-thiazol-2-yl)piperazine-1-carboximidamide (PubChem CID 111079001) has the molecular formula C21H29N5OS and a molecular weight of 399.56 g/mol. Its IUPAC name is N'-[[1-(2-methoxyphenyl)cyclopentyl]methyl]-4-(1,3-thiazol-2-yl)piperazine-1-carboximidamide.
| Compound Name | N'-[[1-(2-methoxyphenyl)cyclopentyl]methyl]-4-(1,3-thiazol-2-yl)piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 111079001 |
| Molecular Formula | C21H29N5OS |
| Molecular Weight | 399.56 g/mol |
| Exact Mass | 399.21 |
| IUPAC Name | N'-[[1-(2-methoxyphenyl)cyclopentyl]methyl]-4-(1,3-thiazol-2-yl)piperazine-1-carboximidamide |
| SMILES | COc1ccccc1C1(C/N=C(\N)N2CCN(c3nccs3)CC2)CCCC1 |
| InChI | InChI=1S/C21H29N5OS/c1-27-18-7-3-2-6-17(18)21(8-4-5-9-21)16-24-19(22)25-11-13-26(14-12-25)20-23-10-15-28-20/h2-3,6-7,10,15H,4-5,8-9,11-14,16H2,1H3,(H2,22,24) |
| InChIKey | GEBUAZONBSSKMZ-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 66.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.56 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|