C17H25ClIN5OS — CID 111093183
N'-[2-[4-(4-chlorophenyl)piperazin-1-yl]-2-oxoethyl]thiomorpholine-4-carboximidamide;hydroiodide (PubChem CID 111093183) has the molecular formula C17H25ClIN5OS and a molecular weight of 509.85 g/mol. Its IUPAC name is N'-[2-[4-(4-chlorophenyl)piperazin-1-yl]-2-oxoethyl]thiomorpholine-4-carboximidamide;hydroiodide.
| Compound Name | N'-[2-[4-(4-chlorophenyl)piperazin-1-yl]-2-oxoethyl]thiomorpholine-4-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111093183 |
| Molecular Formula | C17H25ClIN5OS |
| Molecular Weight | 509.85 g/mol |
| Exact Mass | 509.05 |
| IUPAC Name | N'-[2-[4-(4-chlorophenyl)piperazin-1-yl]-2-oxoethyl]thiomorpholine-4-carboximidamide;hydroiodide |
| SMILES | I.N/C(=N\CC(=O)N1CCN(c2ccc(Cl)cc2)CC1)N1CCSCC1 |
| InChI | InChI=1S/C17H24ClN5OS.HI/c18-14-1-3-15(4-2-14)21-5-7-22(8-6-21)16(24)13-20-17(19)23-9-11-25-12-10-23;/h1-4H,5-13H2,(H2,19,20);1H |
| InChIKey | WAHBPPPNMNSLHV-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 65.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.85 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|