C18H26FN5OS — CID 111072399
N'-[3-[4-(4-fluorophenyl)piperazin-1-yl]-3-oxopropyl]thiomorpholine-4-carboximidamide (PubChem CID 111072399) has the molecular formula C18H26FN5OS and a molecular weight of 379.51 g/mol. Its IUPAC name is N'-[3-[4-(4-fluorophenyl)piperazin-1-yl]-3-oxopropyl]thiomorpholine-4-carboximidamide.
| Compound Name | N'-[3-[4-(4-fluorophenyl)piperazin-1-yl]-3-oxopropyl]thiomorpholine-4-carboximidamide |
|---|---|
| PubChem CID | 111072399 |
| Molecular Formula | C18H26FN5OS |
| Molecular Weight | 379.51 g/mol |
| Exact Mass | 379.18 |
| IUPAC Name | N'-[3-[4-(4-fluorophenyl)piperazin-1-yl]-3-oxopropyl]thiomorpholine-4-carboximidamide |
| SMILES | N/C(=N\CCC(=O)N1CCN(c2ccc(F)cc2)CC1)N1CCSCC1 |
| InChI | InChI=1S/C18H26FN5OS/c19-15-1-3-16(4-2-15)22-7-9-23(10-8-22)17(25)5-6-21-18(20)24-11-13-26-14-12-24/h1-4H,5-14H2,(H2,20,21) |
| InChIKey | DFBIAFWZWMLJCD-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 65.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.51 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|