C18H27ClIN5O — CID 119121156
2-[2-[4-(4-chlorophenyl)piperazin-1-yl]-2-oxoethyl]-1-cyclopentylguanidine;hydroiodide (PubChem CID 119121156) has the molecular formula C18H27ClIN5O and a molecular weight of 491.81 g/mol. Its IUPAC name is 2-[2-[4-(4-chlorophenyl)piperazin-1-yl]-2-oxoethyl]-1-cyclopentylguanidine;hydroiodide.
| Compound Name | 2-[2-[4-(4-chlorophenyl)piperazin-1-yl]-2-oxoethyl]-1-cyclopentylguanidine;hydroiodide |
|---|---|
| PubChem CID | 119121156 |
| Molecular Formula | C18H27ClIN5O |
| Molecular Weight | 491.81 g/mol |
| Exact Mass | 491.09 |
| IUPAC Name | 2-[2-[4-(4-chlorophenyl)piperazin-1-yl]-2-oxoethyl]-1-cyclopentylguanidine;hydroiodide |
| SMILES | I.N/C(=N\CC(=O)N1CCN(c2ccc(Cl)cc2)CC1)NC1CCCC1 |
| InChI | InChI=1S/C18H26ClN5O.HI/c19-14-5-7-16(8-6-14)23-9-11-24(12-10-23)17(25)13-21-18(20)22-15-3-1-2-4-15;/h5-8,15H,1-4,9-13H2,(H3,20,21,22);1H |
| InChIKey | BHGMNLCJNCDRJJ-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 73.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.81 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|