C19H28ClN5O — CID 111093138
2-[2-[4-(4-chlorophenyl)piperazin-1-yl]-2-oxoethyl]-1-cyclohexylguanidine (PubChem CID 111093138) has the molecular formula C19H28ClN5O and a molecular weight of 377.92 g/mol. Its IUPAC name is 2-[2-[4-(4-chlorophenyl)piperazin-1-yl]-2-oxoethyl]-1-cyclohexylguanidine.
| Compound Name | 2-[2-[4-(4-chlorophenyl)piperazin-1-yl]-2-oxoethyl]-1-cyclohexylguanidine |
|---|---|
| PubChem CID | 111093138 |
| Molecular Formula | C19H28ClN5O |
| Molecular Weight | 377.92 g/mol |
| Exact Mass | 377.20 |
| IUPAC Name | 2-[2-[4-(4-chlorophenyl)piperazin-1-yl]-2-oxoethyl]-1-cyclohexylguanidine |
| SMILES | N/C(=N\CC(=O)N1CCN(c2ccc(Cl)cc2)CC1)NC1CCCCC1 |
| InChI | InChI=1S/C19H28ClN5O/c20-15-6-8-17(9-7-15)24-10-12-25(13-11-24)18(26)14-22-19(21)23-16-4-2-1-3-5-16/h6-9,16H,1-5,10-14H2,(H3,21,22,23) |
| InChIKey | WIUHPOAFSZONRZ-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 73.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.92 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|