C18H27ClIN5O — CID 111023124
4-(4-chlorophenyl)-N'-[3-(2-oxopyrrolidin-1-yl)propyl]piperazine-1-carboximidamide;hydroiodide (PubChem CID 111023124) has the molecular formula C18H27ClIN5O and a molecular weight of 491.81 g/mol. Its IUPAC name is 4-(4-chlorophenyl)-N'-[3-(2-oxopyrrolidin-1-yl)propyl]piperazine-1-carboximidamide;hydroiodide.
| Compound Name | 4-(4-chlorophenyl)-N'-[3-(2-oxopyrrolidin-1-yl)propyl]piperazine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111023124 |
| Molecular Formula | C18H27ClIN5O |
| Molecular Weight | 491.81 g/mol |
| Exact Mass | 491.09 |
| IUPAC Name | 4-(4-chlorophenyl)-N'-[3-(2-oxopyrrolidin-1-yl)propyl]piperazine-1-carboximidamide;hydroiodide |
| SMILES | I.N/C(=N\CCCN1CCCC1=O)N1CCN(c2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C18H26ClN5O.HI/c19-15-4-6-16(7-5-15)22-11-13-24(14-12-22)18(20)21-8-2-10-23-9-1-3-17(23)25;/h4-7H,1-3,8-14H2,(H2,20,21);1H |
| InChIKey | ZFHMKASHOKYXQZ-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 65.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.81 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|