C20H31ClIN5O — CID 111030659
4-(4-chlorophenyl)-N'-[3-(2-oxoazepan-1-yl)propyl]piperazine-1-carboximidamide;hydroiodide (PubChem CID 111030659) has the molecular formula C20H31ClIN5O and a molecular weight of 519.86 g/mol. Its IUPAC name is 4-(4-chlorophenyl)-N'-[3-(2-oxoazepan-1-yl)propyl]piperazine-1-carboximidamide;hydroiodide.
| Compound Name | 4-(4-chlorophenyl)-N'-[3-(2-oxoazepan-1-yl)propyl]piperazine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111030659 |
| Molecular Formula | C20H31ClIN5O |
| Molecular Weight | 519.86 g/mol |
| Exact Mass | 519.13 |
| IUPAC Name | 4-(4-chlorophenyl)-N'-[3-(2-oxoazepan-1-yl)propyl]piperazine-1-carboximidamide;hydroiodide |
| SMILES | I.N/C(=N\CCCN1CCCCCC1=O)N1CCN(c2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C20H30ClN5O.HI/c21-17-6-8-18(9-7-17)24-13-15-26(16-14-24)20(22)23-10-4-12-25-11-3-1-2-5-19(25)27;/h6-9H,1-5,10-16H2,(H2,22,23);1H |
| InChIKey | VBPBCSZSHLSETB-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 65.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.86 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|