C19H31FIN5O3S — CID 111811167
4-(4-fluorophenyl)-N'-[2-(oxan-2-ylmethylsulfamoyl)ethyl]piperazine-1-carboximidamide;hydroiodide (PubChem CID 111811167) has the molecular formula C19H31FIN5O3S and a molecular weight of 555.46 g/mol. Its IUPAC name is 4-(4-fluorophenyl)-N'-[2-(oxan-2-ylmethylsulfamoyl)ethyl]piperazine-1-carboximidamide;hydroiodide.
| Compound Name | 4-(4-fluorophenyl)-N'-[2-(oxan-2-ylmethylsulfamoyl)ethyl]piperazine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111811167 |
| Molecular Formula | C19H31FIN5O3S |
| Molecular Weight | 555.46 g/mol |
| Exact Mass | 555.12 |
| IUPAC Name | 4-(4-fluorophenyl)-N'-[2-(oxan-2-ylmethylsulfamoyl)ethyl]piperazine-1-carboximidamide;hydroiodide |
| SMILES | I.N/C(=N\CCS(=O)(=O)NCC1CCCCO1)N1CCN(c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C19H30FN5O3S.HI/c20-16-4-6-17(7-5-16)24-9-11-25(12-10-24)19(21)22-8-14-29(26,27)23-15-18-3-1-2-13-28-18;/h4-7,18,23H,1-3,8-15H2,(H2,21,22);1H |
| InChIKey | STSFSTDILLZQKY-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 100.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.46 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|