C19H30FN5O3S — CID 111811168
4-(4-fluorophenyl)-N'-[2-(oxan-2-ylmethylsulfamoyl)ethyl]piperazine-1-carboximidamide (PubChem CID 111811168) has the molecular formula C19H30FN5O3S and a molecular weight of 427.55 g/mol. Its IUPAC name is 4-(4-fluorophenyl)-N'-[2-(oxan-2-ylmethylsulfamoyl)ethyl]piperazine-1-carboximidamide.
| Compound Name | 4-(4-fluorophenyl)-N'-[2-(oxan-2-ylmethylsulfamoyl)ethyl]piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 111811168 |
| Molecular Formula | C19H30FN5O3S |
| Molecular Weight | 427.55 g/mol |
| Exact Mass | 427.21 |
| IUPAC Name | 4-(4-fluorophenyl)-N'-[2-(oxan-2-ylmethylsulfamoyl)ethyl]piperazine-1-carboximidamide |
| SMILES | N/C(=N\CCS(=O)(=O)NCC1CCCCO1)N1CCN(c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C19H30FN5O3S/c20-16-4-6-17(7-5-16)24-9-11-25(12-10-24)19(21)22-8-14-29(26,27)23-15-18-3-1-2-13-28-18/h4-7,18,23H,1-3,8-15H2,(H2,21,22) |
| InChIKey | JNSXXULKEMZRCL-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 100.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.55 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|