C11H25IN4O3S — CID 119147595
1,1-dimethyl-2-[2-(oxan-2-ylmethylsulfamoyl)ethyl]guanidine;hydroiodide (PubChem CID 119147595) has the molecular formula C11H25IN4O3S and a molecular weight of 420.32 g/mol. Its IUPAC name is 1,1-dimethyl-2-[2-(oxan-2-ylmethylsulfamoyl)ethyl]guanidine;hydroiodide.
| Compound Name | 1,1-dimethyl-2-[2-(oxan-2-ylmethylsulfamoyl)ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 119147595 |
| Molecular Formula | C11H25IN4O3S |
| Molecular Weight | 420.32 g/mol |
| Exact Mass | 420.07 |
| IUPAC Name | 1,1-dimethyl-2-[2-(oxan-2-ylmethylsulfamoyl)ethyl]guanidine;hydroiodide |
| SMILES | CN(C)/C(N)=N/CCS(=O)(=O)NCC1CCCCO1.I |
| InChI | InChI=1S/C11H24N4O3S.HI/c1-15(2)11(12)13-6-8-19(16,17)14-9-10-5-3-4-7-18-10;/h10,14H,3-9H2,1-2H3,(H2,12,13);1H |
| InChIKey | MPCGJHYCEABHEI-UHFFFAOYSA-N |
| XLogP | -0.03 |
| TPSA | 97.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.32 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|