C17H31N5O3S2 — CID 109424718
3-ethyl-1-methyl-1-[(2-methyl-1,3-thiazol-4-yl)methyl]-2-[2-(oxan-2-ylmethylsulfamoyl)ethyl]guanidine (PubChem CID 109424718) has the molecular formula C17H31N5O3S2 and a molecular weight of 417.60 g/mol. Its IUPAC name is 3-ethyl-1-methyl-1-[(2-methyl-1,3-thiazol-4-yl)methyl]-2-[2-(oxan-2-ylmethylsulfamoyl)ethyl]guanidine.
| Compound Name | 3-ethyl-1-methyl-1-[(2-methyl-1,3-thiazol-4-yl)methyl]-2-[2-(oxan-2-ylmethylsulfamoyl)ethyl]guanidine |
|---|---|
| PubChem CID | 109424718 |
| Molecular Formula | C17H31N5O3S2 |
| Molecular Weight | 417.60 g/mol |
| Exact Mass | 417.19 |
| IUPAC Name | 3-ethyl-1-methyl-1-[(2-methyl-1,3-thiazol-4-yl)methyl]-2-[2-(oxan-2-ylmethylsulfamoyl)ethyl]guanidine |
| SMILES | CCN/C(=N\CCS(=O)(=O)NCC1CCCCO1)N(C)Cc1csc(C)n1 |
| InChI | InChI=1S/C17H31N5O3S2/c1-4-18-17(22(3)12-15-13-26-14(2)21-15)19-8-10-27(23,24)20-11-16-7-5-6-9-25-16/h13,16,20H,4-12H2,1-3H3,(H,18,19) |
| InChIKey | ATLPNCNONGERTB-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 95.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.60 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|