C15H30N4O3S — CID 111826122
N-ethyl-N'-[2-(oxan-2-ylmethylsulfamoyl)ethyl]pyrrolidine-1-carboximidamide (PubChem CID 111826122) has the molecular formula C15H30N4O3S and a molecular weight of 346.50 g/mol. Its IUPAC name is N-ethyl-N'-[2-(oxan-2-ylmethylsulfamoyl)ethyl]pyrrolidine-1-carboximidamide.
| Compound Name | N-ethyl-N'-[2-(oxan-2-ylmethylsulfamoyl)ethyl]pyrrolidine-1-carboximidamide |
|---|---|
| PubChem CID | 111826122 |
| Molecular Formula | C15H30N4O3S |
| Molecular Weight | 346.50 g/mol |
| Exact Mass | 346.20 |
| IUPAC Name | N-ethyl-N'-[2-(oxan-2-ylmethylsulfamoyl)ethyl]pyrrolidine-1-carboximidamide |
| SMILES | CCN/C(=N\CCS(=O)(=O)NCC1CCCCO1)N1CCCC1 |
| InChI | InChI=1S/C15H30N4O3S/c1-2-16-15(19-9-4-5-10-19)17-8-12-23(20,21)18-13-14-7-3-6-11-22-14/h14,18H,2-13H2,1H3,(H,16,17) |
| InChIKey | AUYHWJASEPHXDZ-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 83.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.50 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|