C20H26FN5O2S — CID 111043812
4-(4-fluorophenyl)-N'-[2-[(4-methylphenyl)sulfonylamino]ethyl]piperazine-1-carboximidamide (PubChem CID 111043812) has the molecular formula C20H26FN5O2S and a molecular weight of 419.53 g/mol. Its IUPAC name is 4-(4-fluorophenyl)-N'-[2-[(4-methylphenyl)sulfonylamino]ethyl]piperazine-1-carboximidamide.
| Compound Name | 4-(4-fluorophenyl)-N'-[2-[(4-methylphenyl)sulfonylamino]ethyl]piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 111043812 |
| Molecular Formula | C20H26FN5O2S |
| Molecular Weight | 419.53 g/mol |
| Exact Mass | 419.18 |
| IUPAC Name | 4-(4-fluorophenyl)-N'-[2-[(4-methylphenyl)sulfonylamino]ethyl]piperazine-1-carboximidamide |
| SMILES | Cc1ccc(S(=O)(=O)NCC/N=C(\N)N2CCN(c3ccc(F)cc3)CC2)cc1 |
| InChI | InChI=1S/C20H26FN5O2S/c1-16-2-8-19(9-3-16)29(27,28)24-11-10-23-20(22)26-14-12-25(13-15-26)18-6-4-17(21)5-7-18/h2-9,24H,10-15H2,1H3,(H2,22,23) |
| InChIKey | YQTIJKHHSCBVLH-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 91.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.53 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|