C16H25FN4O2S — CID 111752144
4-(4-fluorophenyl)-N'-(2-methyl-2-methylsulfonylpropyl)piperazine-1-carboximidamide (PubChem CID 111752144) has the molecular formula C16H25FN4O2S and a molecular weight of 356.47 g/mol. Its IUPAC name is 4-(4-fluorophenyl)-N'-(2-methyl-2-methylsulfonylpropyl)piperazine-1-carboximidamide.
| Compound Name | 4-(4-fluorophenyl)-N'-(2-methyl-2-methylsulfonylpropyl)piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 111752144 |
| Molecular Formula | C16H25FN4O2S |
| Molecular Weight | 356.47 g/mol |
| Exact Mass | 356.17 |
| IUPAC Name | 4-(4-fluorophenyl)-N'-(2-methyl-2-methylsulfonylpropyl)piperazine-1-carboximidamide |
| SMILES | CC(C)(C/N=C(\N)N1CCN(c2ccc(F)cc2)CC1)S(C)(=O)=O |
| InChI | InChI=1S/C16H25FN4O2S/c1-16(2,24(3,22)23)12-19-15(18)21-10-8-20(9-11-21)14-6-4-13(17)5-7-14/h4-7H,8-12H2,1-3H3,(H2,18,19) |
| InChIKey | OWZVITCXKDBMQH-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 79.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.47 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|