C18H28FN5O2S — CID 120973595
4-(4-fluorophenyl)-N'-[(1-methylsulfonylpiperidin-2-yl)methyl]piperazine-1-carboximidamide (PubChem CID 120973595) has the molecular formula C18H28FN5O2S and a molecular weight of 397.52 g/mol. Its IUPAC name is 4-(4-fluorophenyl)-N'-[(1-methylsulfonylpiperidin-2-yl)methyl]piperazine-1-carboximidamide.
| Compound Name | 4-(4-fluorophenyl)-N'-[(1-methylsulfonylpiperidin-2-yl)methyl]piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 120973595 |
| Molecular Formula | C18H28FN5O2S |
| Molecular Weight | 397.52 g/mol |
| Exact Mass | 397.19 |
| IUPAC Name | 4-(4-fluorophenyl)-N'-[(1-methylsulfonylpiperidin-2-yl)methyl]piperazine-1-carboximidamide |
| SMILES | CS(=O)(=O)N1CCCCC1C/N=C(\N)N1CCN(c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C18H28FN5O2S/c1-27(25,26)24-9-3-2-4-17(24)14-21-18(20)23-12-10-22(11-13-23)16-7-5-15(19)6-8-16/h5-8,17H,2-4,9-14H2,1H3,(H2,20,21) |
| InChIKey | FJXRFOWUXWCZBY-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 82.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.52 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|