C19H29F2N5O2S — CID 109450491
4-(2,5-difluorophenyl)-N-ethyl-N'-[[(2R)-1-methylsulfonylpyrrolidin-2-yl]methyl]piperazine-1-carboximidamide (PubChem CID 109450491) has the molecular formula C19H29F2N5O2S and a molecular weight of 429.54 g/mol. Its IUPAC name is 4-(2,5-difluorophenyl)-N-ethyl-N'-[[(2R)-1-methylsulfonylpyrrolidin-2-yl]methyl]piperazine-1-carboximidamide.
| Compound Name | 4-(2,5-difluorophenyl)-N-ethyl-N'-[[(2R)-1-methylsulfonylpyrrolidin-2-yl]methyl]piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 109450491 |
| Molecular Formula | C19H29F2N5O2S |
| Molecular Weight | 429.54 g/mol |
| Exact Mass | 429.20 |
| IUPAC Name | 4-(2,5-difluorophenyl)-N-ethyl-N'-[[(2R)-1-methylsulfonylpyrrolidin-2-yl]methyl]piperazine-1-carboximidamide |
| SMILES | CCN/C(=N\C[C@H]1CCCN1S(C)(=O)=O)N1CCN(c2cc(F)ccc2F)CC1 |
| InChI | InChI=1S/C19H29F2N5O2S/c1-3-22-19(23-14-16-5-4-8-26(16)29(2,27)28)25-11-9-24(10-12-25)18-13-15(20)6-7-17(18)21/h6-7,13,16H,3-5,8-12,14H2,1-2H3,(H,22,23)/t16-/m1/s1 |
| InChIKey | GMWZMLORCOCEQS-MRXNPFEDSA-N |
| XLogP | 1.48 |
| TPSA | 68.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.54 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|