C16H24FIN4O2S — CID 111045921
N'-[(1,1-dioxothiolan-3-yl)methyl]-4-(4-fluorophenyl)piperazine-1-carboximidamide;hydroiodide (PubChem CID 111045921) has the molecular formula C16H24FIN4O2S and a molecular weight of 482.36 g/mol. Its IUPAC name is N'-[(1,1-dioxothiolan-3-yl)methyl]-4-(4-fluorophenyl)piperazine-1-carboximidamide;hydroiodide.
| Compound Name | N'-[(1,1-dioxothiolan-3-yl)methyl]-4-(4-fluorophenyl)piperazine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111045921 |
| Molecular Formula | C16H24FIN4O2S |
| Molecular Weight | 482.36 g/mol |
| Exact Mass | 482.06 |
| IUPAC Name | N'-[(1,1-dioxothiolan-3-yl)methyl]-4-(4-fluorophenyl)piperazine-1-carboximidamide;hydroiodide |
| SMILES | I.N/C(=N\CC1CCS(=O)(=O)C1)N1CCN(c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C16H23FN4O2S.HI/c17-14-1-3-15(4-2-14)20-6-8-21(9-7-20)16(18)19-11-13-5-10-24(22,23)12-13;/h1-4,13H,5-12H2,(H2,18,19);1H |
| InChIKey | NOZVZRBAGVGRKB-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 79.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.36 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|