C16H24FIN4O2 — CID 119119468
N'-(1,4-dioxan-2-ylmethyl)-4-(4-fluorophenyl)piperazine-1-carboximidamide;hydroiodide (PubChem CID 119119468) has the molecular formula C16H24FIN4O2 and a molecular weight of 450.30 g/mol. Its IUPAC name is N'-(1,4-dioxan-2-ylmethyl)-4-(4-fluorophenyl)piperazine-1-carboximidamide;hydroiodide.
| Compound Name | N'-(1,4-dioxan-2-ylmethyl)-4-(4-fluorophenyl)piperazine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 119119468 |
| Molecular Formula | C16H24FIN4O2 |
| Molecular Weight | 450.30 g/mol |
| Exact Mass | 450.09 |
| IUPAC Name | N'-(1,4-dioxan-2-ylmethyl)-4-(4-fluorophenyl)piperazine-1-carboximidamide;hydroiodide |
| SMILES | I.N/C(=N\CC1COCCO1)N1CCN(c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C16H23FN4O2.HI/c17-13-1-3-14(4-2-13)20-5-7-21(8-6-20)16(18)19-11-15-12-22-9-10-23-15;/h1-4,15H,5-12H2,(H2,18,19);1H |
| InChIKey | GZIDMSIZRZPUCZ-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.30 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|