C17H26FIN4O2 — CID 111801469
tert-butyl 2-[[amino-[4-(4-fluorophenyl)piperazin-1-yl]methylidene]amino]acetate;hydroiodide (PubChem CID 111801469) has the molecular formula C17H26FIN4O2 and a molecular weight of 464.32 g/mol. Its IUPAC name is tert-butyl 2-[[amino-[4-(4-fluorophenyl)piperazin-1-yl]methylidene]amino]acetate;hydroiodide.
| Compound Name | tert-butyl 2-[[amino-[4-(4-fluorophenyl)piperazin-1-yl]methylidene]amino]acetate;hydroiodide |
|---|---|
| PubChem CID | 111801469 |
| Molecular Formula | C17H26FIN4O2 |
| Molecular Weight | 464.32 g/mol |
| Exact Mass | 464.11 |
| IUPAC Name | tert-butyl 2-[[amino-[4-(4-fluorophenyl)piperazin-1-yl]methylidene]amino]acetate;hydroiodide |
| SMILES | CC(C)(C)OC(=O)C/N=C(\N)N1CCN(c2ccc(F)cc2)CC1.I |
| InChI | InChI=1S/C17H25FN4O2.HI/c1-17(2,3)24-15(23)12-20-16(19)22-10-8-21(9-11-22)14-6-4-13(18)5-7-14;/h4-7H,8-12H2,1-3H3,(H2,19,20);1H |
| InChIKey | WXBCHTABGPDWKV-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 71.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.32 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|