C12H17N5O4 — CID 12919353
ethyl 4-(6-amino-3-nitro-2-pyridinyl)piperazine-1-carboxylate (PubChem CID 12919353) has the molecular formula C12H17N5O4 and a molecular weight of 295.30 g/mol. Its IUPAC name is ethyl 4-(6-amino-3-nitro-2-pyridinyl)piperazine-1-carboxylate.
| Compound Name | ethyl 4-(6-amino-3-nitro-2-pyridinyl)piperazine-1-carboxylate |
|---|---|
| PubChem CID | 12919353 |
| Molecular Formula | C12H17N5O4 |
| Molecular Weight | 295.30 g/mol |
| Exact Mass | 295.13 |
| IUPAC Name | ethyl 4-(6-amino-3-nitro-2-pyridinyl)piperazine-1-carboxylate |
| SMILES | CCOC(=O)N1CCN(c2nc(N)ccc2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C12H17N5O4/c1-2-21-12(18)16-7-5-15(6-8-16)11-9(17(19)20)3-4-10(13)14-11/h3-4H,2,5-8H2,1H3,(H2,13,14) |
| InChIKey | KOLLAFJZPNUYKT-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 114.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.30 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|