C14H10BrN5O3S — CID 137130304
4-bromo-2-[4-methyl-5-[(3-nitro-2-pyridinyl)sulfanyl]-1,2,4-triazol-3-yl]phenol (PubChem CID 137130304) has the molecular formula C14H10BrN5O3S and a molecular weight of 408.24 g/mol. Its IUPAC name is 4-bromo-2-[4-methyl-5-[(3-nitro-2-pyridinyl)sulfanyl]-1,2,4-triazol-3-yl]phenol.
| Compound Name | 4-bromo-2-[4-methyl-5-[(3-nitro-2-pyridinyl)sulfanyl]-1,2,4-triazol-3-yl]phenol |
|---|---|
| PubChem CID | 137130304 |
| Molecular Formula | C14H10BrN5O3S |
| Molecular Weight | 408.24 g/mol |
| Exact Mass | 406.97 |
| IUPAC Name | 4-bromo-2-[4-methyl-5-[(3-nitro-2-pyridinyl)sulfanyl]-1,2,4-triazol-3-yl]phenol |
| SMILES | Cn1c(Sc2ncccc2[N+](=O)[O-])nnc1-c1cc(Br)ccc1O |
| InChI | InChI=1S/C14H10BrN5O3S/c1-19-12(9-7-8(15)4-5-11(9)21)17-18-14(19)24-13-10(20(22)23)3-2-6-16-13/h2-7,21H,1H3 |
| InChIKey | AAMHGDGXXNLTMO-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 106.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.24 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|