C13H16N6O3S — CID 6493023
4-[[4-methyl-5-[(3-nitro-2-pyridinyl)sulfanyl]-1,2,4-triazol-3-yl]methyl]morpholine (PubChem CID 6493023) has the molecular formula C13H16N6O3S and a molecular weight of 336.38 g/mol. Its IUPAC name is 4-[[4-methyl-5-[(3-nitro-2-pyridinyl)sulfanyl]-1,2,4-triazol-3-yl]methyl]morpholine.
| Compound Name | 4-[[4-methyl-5-[(3-nitro-2-pyridinyl)sulfanyl]-1,2,4-triazol-3-yl]methyl]morpholine |
|---|---|
| PubChem CID | 6493023 |
| Molecular Formula | C13H16N6O3S |
| Molecular Weight | 336.38 g/mol |
| Exact Mass | 336.10 |
| IUPAC Name | 4-[[4-methyl-5-[(3-nitro-2-pyridinyl)sulfanyl]-1,2,4-triazol-3-yl]methyl]morpholine |
| SMILES | Cn1c(CN2CCOCC2)nnc1Sc1ncccc1[N+](=O)[O-] |
| InChI | InChI=1S/C13H16N6O3S/c1-17-11(9-18-5-7-22-8-6-18)15-16-13(17)23-12-10(19(20)21)3-2-4-14-12/h2-4H,5-9H2,1H3 |
| InChIKey | FYFVNHZIKDYRBC-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 99.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.38 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|