C15H16N6O3S — CID 56736802
4-[[6-(2-methyl-3-nitrophenyl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-3-yl]methyl]morpholine (PubChem CID 56736802) has the molecular formula C15H16N6O3S and a molecular weight of 360.40 g/mol. Its IUPAC name is 4-[[6-(2-methyl-3-nitrophenyl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-3-yl]methyl]morpholine.
| Compound Name | 4-[[6-(2-methyl-3-nitrophenyl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-3-yl]methyl]morpholine |
|---|---|
| PubChem CID | 56736802 |
| Molecular Formula | C15H16N6O3S |
| Molecular Weight | 360.40 g/mol |
| Exact Mass | 360.10 |
| IUPAC Name | 4-[[6-(2-methyl-3-nitrophenyl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-3-yl]methyl]morpholine |
| SMILES | Cc1c(-c2nn3c(CN4CCOCC4)nnc3s2)cccc1[N+](=O)[O-] |
| InChI | InChI=1S/C15H16N6O3S/c1-10-11(3-2-4-12(10)21(22)23)14-18-20-13(16-17-15(20)25-14)9-19-5-7-24-8-6-19/h2-4H,5-9H2,1H3 |
| InChIKey | SLRBFHBMVOHMJF-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 98.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.40 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|