C14H14N6O3S — CID 56736798
4-[[6-(2-nitrophenyl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-3-yl]methyl]morpholine (PubChem CID 56736798) has the molecular formula C14H14N6O3S and a molecular weight of 346.37 g/mol. Its IUPAC name is 4-[[6-(2-nitrophenyl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-3-yl]methyl]morpholine.
| Compound Name | 4-[[6-(2-nitrophenyl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-3-yl]methyl]morpholine |
|---|---|
| PubChem CID | 56736798 |
| Molecular Formula | C14H14N6O3S |
| Molecular Weight | 346.37 g/mol |
| Exact Mass | 346.08 |
| IUPAC Name | 4-[[6-(2-nitrophenyl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-3-yl]methyl]morpholine |
| SMILES | O=[N+]([O-])c1ccccc1-c1nn2c(CN3CCOCC3)nnc2s1 |
| InChI | InChI=1S/C14H14N6O3S/c21-20(22)11-4-2-1-3-10(11)13-17-19-12(15-16-14(19)24-13)9-18-5-7-23-8-6-18/h1-4H,5-9H2 |
| InChIKey | ITOTWSBHVJWCNC-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 98.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.37 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|