C7H4N4O2S3 — CID 2765811
5-[(3-nitro-2-pyridinyl)sulfanyl]-3H-1,3,4-thiadiazole-2-thione (PubChem CID 2765811) has the molecular formula C7H4N4O2S3 and a molecular weight of 272.34 g/mol. Its IUPAC name is 5-[(3-nitro-2-pyridinyl)sulfanyl]-3H-1,3,4-thiadiazole-2-thione.
| Compound Name | 5-[(3-nitro-2-pyridinyl)sulfanyl]-3H-1,3,4-thiadiazole-2-thione |
|---|---|
| PubChem CID | 2765811 |
| Molecular Formula | C7H4N4O2S3 |
| Molecular Weight | 272.34 g/mol |
| Exact Mass | 271.95 |
| IUPAC Name | 5-[(3-nitro-2-pyridinyl)sulfanyl]-3H-1,3,4-thiadiazole-2-thione |
| SMILES | O=[N+]([O-])c1cccnc1Sc1n[nH]c(=S)s1 |
| InChI | InChI=1S/C7H4N4O2S3/c12-11(13)4-2-1-3-8-5(4)15-7-10-9-6(14)16-7/h1-3H,(H,9,14) |
| InChIKey | APDJURLGRLOQEF-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 84.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.34 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|