C14H21N3OS — CID 105325091
[1-(1,3-benzothiazol-2-yl)-5-ethoxypentan-2-yl]hydrazine (PubChem CID 105325091) has the molecular formula C14H21N3OS and a molecular weight of 279.41 g/mol. Its IUPAC name is [1-(1,3-benzothiazol-2-yl)-5-ethoxypentan-2-yl]hydrazine.
| Compound Name | [1-(1,3-benzothiazol-2-yl)-5-ethoxypentan-2-yl]hydrazine |
|---|---|
| PubChem CID | 105325091 |
| Molecular Formula | C14H21N3OS |
| Molecular Weight | 279.41 g/mol |
| Exact Mass | 279.14 |
| IUPAC Name | [1-(1,3-benzothiazol-2-yl)-5-ethoxypentan-2-yl]hydrazine |
| SMILES | CCOCCCC(Cc1nc2ccccc2s1)NN |
| InChI | InChI=1S/C14H21N3OS/c1-2-18-9-5-6-11(17-15)10-14-16-12-7-3-4-8-13(12)19-14/h3-4,7-8,11,17H,2,5-6,9-10,15H2,1H3 |
| InChIKey | LVFYFEIMTDVHMH-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.41 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|