C18H25N5O4S3 — CID 24525961
N-tert-butyl-5-[4-(3-methylpiperidin-1-yl)sulfonyl-2-nitrophenyl]sulfanyl-1,3,4-thiadiazol-2-amine (PubChem CID 24525961) has the molecular formula C18H25N5O4S3 and a molecular weight of 471.63 g/mol. Its IUPAC name is N-tert-butyl-5-[4-(3-methylpiperidin-1-yl)sulfonyl-2-nitrophenyl]sulfanyl-1,3,4-thiadiazol-2-amine.
| Compound Name | N-tert-butyl-5-[4-(3-methylpiperidin-1-yl)sulfonyl-2-nitrophenyl]sulfanyl-1,3,4-thiadiazol-2-amine |
|---|---|
| PubChem CID | 24525961 |
| Molecular Formula | C18H25N5O4S3 |
| Molecular Weight | 471.63 g/mol |
| Exact Mass | 471.11 |
| IUPAC Name | N-tert-butyl-5-[4-(3-methylpiperidin-1-yl)sulfonyl-2-nitrophenyl]sulfanyl-1,3,4-thiadiazol-2-amine |
| SMILES | CC1CCCN(S(=O)(=O)c2ccc(Sc3nnc(NC(C)(C)C)s3)c([N+](=O)[O-])c2)C1 |
| InChI | InChI=1S/C18H25N5O4S3/c1-12-6-5-9-22(11-12)30(26,27)13-7-8-15(14(10-13)23(24)25)28-17-21-20-16(29-17)19-18(2,3)4/h7-8,10,12H,5-6,9,11H2,1-4H3,(H,19,20) |
| InChIKey | AXKCRPRRCDGWFZ-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 118.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.63 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|