C22H25N5O4S2 — CID 24566868
1-[4-[(5-benzyl-4-methyl-1,2,4-triazol-3-yl)sulfanyl]-3-nitrophenyl]sulfonyl-3-methylpiperidine (PubChem CID 24566868) has the molecular formula C22H25N5O4S2 and a molecular weight of 487.61 g/mol. Its IUPAC name is 1-[4-[(5-benzyl-4-methyl-1,2,4-triazol-3-yl)sulfanyl]-3-nitrophenyl]sulfonyl-3-methylpiperidine.
| Compound Name | 1-[4-[(5-benzyl-4-methyl-1,2,4-triazol-3-yl)sulfanyl]-3-nitrophenyl]sulfonyl-3-methylpiperidine |
|---|---|
| PubChem CID | 24566868 |
| Molecular Formula | C22H25N5O4S2 |
| Molecular Weight | 487.61 g/mol |
| Exact Mass | 487.13 |
| IUPAC Name | 1-[4-[(5-benzyl-4-methyl-1,2,4-triazol-3-yl)sulfanyl]-3-nitrophenyl]sulfonyl-3-methylpiperidine |
| SMILES | CC1CCCN(S(=O)(=O)c2ccc(Sc3nnc(Cc4ccccc4)n3C)c([N+](=O)[O-])c2)C1 |
| InChI | InChI=1S/C22H25N5O4S2/c1-16-7-6-12-26(15-16)33(30,31)18-10-11-20(19(14-18)27(28)29)32-22-24-23-21(25(22)2)13-17-8-4-3-5-9-17/h3-5,8-11,14,16H,6-7,12-13,15H2,1-2H3 |
| InChIKey | GJAIQVOSTMUXHW-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 111.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.61 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|